C25H24ClN3O3 — CID 59242140
N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3,4-diethoxy-5-methylbenzamide (PubChem CID 59242140) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3,4-diethoxy-5-methylbenzamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3,4-diethoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 59242140 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3,4-diethoxy-5-methylbenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(Cl)c(-c3nc4ccccc4[nH]3)c2)cc(C)c1OCC |
| InChI | InChI=1S/C25H24ClN3O3/c1-4-31-22-13-16(12-15(3)23(22)32-5-2)25(30)27-17-10-11-19(26)18(14-17)24-28-20-8-6-7-9-21(20)29-24/h6-14H,4-5H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | VWPCJKVJLGYBMS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |