C23H19ClN4O2S — CID 17104338
N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-2-methoxy-3-methylbenzamide (PubChem CID 17104338) has the molecular formula C23H19ClN4O2S and a molecular weight of 450.95 g/mol. Its IUPAC name is N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-2-methoxy-3-methylbenzamide.
| Compound Name | N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 17104338 |
| Molecular Formula | C23H19ClN4O2S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N-[[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]carbamothioyl]-2-methoxy-3-methylbenzamide |
| SMILES | COc1c(C)cccc1C(=O)NC(=S)Nc1ccc(Cl)c(-c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C23H19ClN4O2S/c1-13-6-5-7-15(20(13)30-2)22(29)28-23(31)25-14-10-11-17(24)16(12-14)21-26-18-8-3-4-9-19(18)27-21/h3-12H,1-2H3,(H,26,27)(H2,25,28,29,31) |
| InChIKey | BRQJRDUYJKDMRW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|