C22H17ClN4OS — CID 22777518
N-[[3-(1H-benzimidazol-2-yl)phenyl]carbamothioyl]-3-chloro-4-methylbenzamide (PubChem CID 22777518) has the molecular formula C22H17ClN4OS and a molecular weight of 420.93 g/mol. Its IUPAC name is N-[[3-(1H-benzimidazol-2-yl)phenyl]carbamothioyl]-3-chloro-4-methylbenzamide.
| Compound Name | N-[[3-(1H-benzimidazol-2-yl)phenyl]carbamothioyl]-3-chloro-4-methylbenzamide |
|---|---|
| PubChem CID | 22777518 |
| Molecular Formula | C22H17ClN4OS |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-[[3-(1H-benzimidazol-2-yl)phenyl]carbamothioyl]-3-chloro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cccc(-c3nc4ccccc4[nH]3)c2)cc1Cl |
| InChI | InChI=1S/C22H17ClN4OS/c1-13-9-10-15(12-17(13)23)21(28)27-22(29)24-16-6-4-5-14(11-16)20-25-18-7-2-3-8-19(18)26-20/h2-12H,1H3,(H,25,26)(H2,24,27,28,29) |
| InChIKey | OVIQEIIXMDRHRA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|