C23H14Cl2N4OS2 — CID 17114807
N-[[3-(1H-benzimidazol-2-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 17114807) has the molecular formula C23H14Cl2N4OS2 and a molecular weight of 497.43 g/mol. Its IUPAC name is N-[[3-(1H-benzimidazol-2-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[3-(1H-benzimidazol-2-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17114807 |
| Molecular Formula | C23H14Cl2N4OS2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.00 |
| IUPAC Name | N-[[3-(1H-benzimidazol-2-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2nc3ccccc3[nH]2)c1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C23H14Cl2N4OS2/c24-13-8-9-15-18(11-13)32-20(19(15)25)22(30)29-23(31)26-14-5-3-4-12(10-14)21-27-16-6-1-2-7-17(16)28-21/h1-11H,(H,27,28)(H2,26,29,30,31) |
| InChIKey | NRAMFBSNBPUKOC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|