C13H9Cl2N3OS3 — CID 5025451
3,6-dichloro-N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-1-benzothiophene-2-carboxamide (PubChem CID 5025451) has the molecular formula C13H9Cl2N3OS3 and a molecular weight of 390.34 g/mol. Its IUPAC name is 3,6-dichloro-N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 5025451 |
| Molecular Formula | C13H9Cl2N3OS3 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | 3,6-dichloro-N-(4,5-dihydro-1,3-thiazol-2-ylcarbamothioyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)NC1=NCCS1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C13H9Cl2N3OS3/c14-6-1-2-7-8(5-6)22-10(9(7)15)11(19)17-12(20)18-13-16-3-4-21-13/h1-2,5H,3-4H2,(H2,16,17,18,19,20) |
| InChIKey | XVBCVNGWUCNYPU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|