C23H13Cl2N3OS3 — CID 17114718
N-[[2-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 17114718) has the molecular formula C23H13Cl2N3OS3 and a molecular weight of 514.48 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17114718 |
| Molecular Formula | C23H13Cl2N3OS3 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 512.96 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1-c1nc2ccccc2s1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C23H13Cl2N3OS3/c24-12-9-10-14-18(11-12)31-20(19(14)25)21(29)28-23(30)27-15-6-2-1-5-13(15)22-26-16-7-3-4-8-17(16)32-22/h1-11H,(H2,27,28,29,30) |
| InChIKey | RYGIMLSGCUYKSU-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|