C22H16ClN3O2S2 — CID 22782986
N-[[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-methoxybenzamide (PubChem CID 22782986) has the molecular formula C22H16ClN3O2S2 and a molecular weight of 453.98 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-methoxybenzamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 22782986 |
| Molecular Formula | C22H16ClN3O2S2 |
| Molecular Weight | 453.98 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]carbamothioyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(=S)Nc2ccc(Cl)cc2-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H16ClN3O2S2/c1-28-15-6-4-5-13(11-15)20(27)26-22(29)25-17-10-9-14(23)12-16(17)21-24-18-7-2-3-8-19(18)30-21/h2-12H,1H3,(H2,25,26,27,29) |
| InChIKey | LBWXIKUTVZBLFZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.98 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|