C22H17N3O2S2 — CID 1339505
N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-methoxybenzamide (PubChem CID 1339505) has the molecular formula C22H17N3O2S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-methoxybenzamide.
| Compound Name | N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 1339505 |
| Molecular Formula | C22H17N3O2S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC(=S)Nc2cccc(-c3nc4ccccc4s3)c2)c1 |
| InChI | InChI=1S/C22H17N3O2S2/c1-27-17-9-5-6-14(13-17)20(26)25-22(28)23-16-8-4-7-15(12-16)21-24-18-10-2-3-11-19(18)29-21/h2-13H,1H3,(H2,23,25,26,28) |
| InChIKey | PVMWJLWDRFNRPA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|