C26H25N3O3S2 — CID 4508371
N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3-butoxybenzamide (PubChem CID 4508371) has the molecular formula C26H25N3O3S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3-butoxybenzamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3-butoxybenzamide |
|---|---|
| PubChem CID | 4508371 |
| Molecular Formula | C26H25N3O3S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3-butoxybenzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2cc(-c3nc4ccccc4s3)ccc2OC)c1 |
| InChI | InChI=1S/C26H25N3O3S2/c1-3-4-14-32-19-9-7-8-17(15-19)24(30)29-26(33)28-21-16-18(12-13-22(21)31-2)25-27-20-10-5-6-11-23(20)34-25/h5-13,15-16H,3-4,14H2,1-2H3,(H2,28,29,30,33) |
| InChIKey | BOCRFYMHWAXZSI-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|