C19H19N3O2S2 — CID 3744571
N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2-methylpropanamide (PubChem CID 3744571) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2-methylpropanamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 3744571 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2-methylpropanamide |
| SMILES | COc1ccc(-c2nc3ccccc3s2)cc1NC(=S)NC(=O)C(C)C |
| InChI | InChI=1S/C19H19N3O2S2/c1-11(2)17(23)22-19(25)21-14-10-12(8-9-15(14)24-3)18-20-13-6-4-5-7-16(13)26-18/h4-11H,1-3H3,(H2,21,22,23,25) |
| InChIKey | QRQKDYNGKYZNDA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|