C22H15N5O2S3 — CID 17274677
N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17274677) has the molecular formula C22H15N5O2S3 and a molecular weight of 477.60 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17274677 |
| Molecular Formula | C22H15N5O2S3 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | COc1ccc(-c2nc3ccccc3s2)cc1NC(=S)NC(=O)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C22H15N5O2S3/c1-29-18-9-7-13(21-23-15-4-2-3-5-19(15)31-21)11-17(18)24-22(30)25-20(28)12-6-8-14-16(10-12)27-32-26-14/h2-11H,1H3,(H2,24,25,28,30) |
| InChIKey | JVDTYBHUHVZVHI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|