C23H18ClN3OS2 — CID 22782740
N-[[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]carbamothioyl]-3,5-dimethylbenzamide (PubChem CID 22782740) has the molecular formula C23H18ClN3OS2 and a molecular weight of 452.00 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]carbamothioyl]-3,5-dimethylbenzamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]carbamothioyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 22782740 |
| Molecular Formula | C23H18ClN3OS2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2-chlorophenyl]carbamothioyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC(=S)Nc2cc(-c3nc4ccccc4s3)ccc2Cl)c1 |
| InChI | InChI=1S/C23H18ClN3OS2/c1-13-9-14(2)11-16(10-13)21(28)27-23(29)26-19-12-15(7-8-17(19)24)22-25-18-5-3-4-6-20(18)30-22/h3-12H,1-2H3,(H2,26,27,28,29) |
| InChIKey | ROMDLEUCHSYJTC-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|