C22H14BrCl2N3O2S2 — CID 4651005
N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-bromo-4-methoxybenzamide (PubChem CID 4651005) has the molecular formula C22H14BrCl2N3O2S2 and a molecular weight of 567.32 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-bromo-4-methoxybenzamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-bromo-4-methoxybenzamide |
|---|---|
| PubChem CID | 4651005 |
| Molecular Formula | C22H14BrCl2N3O2S2 |
| Molecular Weight | 567.32 g/mol |
| Exact Mass | 564.91 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-bromo-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cc(-c3nc4ccccc4s3)c(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C22H14BrCl2N3O2S2/c1-30-18-7-6-11(8-13(18)23)20(29)28-22(31)27-17-9-12(14(24)10-15(17)25)21-26-16-4-2-3-5-19(16)32-21/h2-10H,1H3,(H2,27,28,29,31) |
| InChIKey | PSRIODXGWYCYEK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.32 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|