C20H12Cl2N2OS — CID 4210852
N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]benzamide (PubChem CID 4210852) has the molecular formula C20H12Cl2N2OS and a molecular weight of 399.30 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]benzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]benzamide |
|---|---|
| PubChem CID | 4210852 |
| Molecular Formula | C20H12Cl2N2OS |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]benzamide |
| SMILES | O=C(Nc1cc(-c2nc3ccccc3s2)c(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C20H12Cl2N2OS/c21-14-11-15(22)17(23-19(25)12-6-2-1-3-7-12)10-13(14)20-24-16-8-4-5-9-18(16)26-20/h1-11H,(H,23,25) |
| InChIKey | IBRSWLRFPGCFGD-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |