C24H20Cl2N2O2S — CID 4233678
N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]-4-butoxybenzamide (PubChem CID 4233678) has the molecular formula C24H20Cl2N2O2S and a molecular weight of 471.41 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]-4-butoxybenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 4233678 |
| Molecular Formula | C24H20Cl2N2O2S |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cc(-c3nc4ccccc4s3)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C24H20Cl2N2O2S/c1-2-3-12-30-16-10-8-15(9-11-16)23(29)27-21-13-17(18(25)14-19(21)26)24-28-20-6-4-5-7-22(20)31-24/h4-11,13-14H,2-3,12H2,1H3,(H,27,29) |
| InChIKey | RNLWNEXNIYTSDW-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|