C28H30N2O2S2 — CID 4122292
N-[3-(1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-4-pentoxybenzamide (PubChem CID 4122292) has the molecular formula C28H30N2O2S2 and a molecular weight of 490.69 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-4-pentoxybenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 4122292 |
| Molecular Formula | C28H30N2O2S2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2sc3c(c2-c2nc4ccccc4s2)CCCCC3)cc1 |
| InChI | InChI=1S/C28H30N2O2S2/c1-2-3-9-18-32-20-16-14-19(15-17-20)26(31)30-28-25(21-10-5-4-6-12-23(21)33-28)27-29-22-11-7-8-13-24(22)34-27/h7-8,11,13-17H,2-6,9-10,12,18H2,1H3,(H,30,31) |
| InChIKey | YODNZCJWSQVHOO-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|