C24H22N2OS2 — CID 4306824
N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3,4-dimethylbenzamide (PubChem CID 4306824) has the molecular formula C24H22N2OS2 and a molecular weight of 418.59 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 4306824 |
| Molecular Formula | C24H22N2OS2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2sc3c(c2-c2nc4ccccc4s2)CCCC3)cc1C |
| InChI | InChI=1S/C24H22N2OS2/c1-14-11-12-16(13-15(14)2)22(27)26-24-21(17-7-3-5-9-19(17)28-24)23-25-18-8-4-6-10-20(18)29-23/h4,6,8,10-13H,3,5,7,9H2,1-2H3,(H,26,27) |
| InChIKey | BTXGGMMYPVTBOP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |