C28H29N3O4S3 — CID 23879097
N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 23879097) has the molecular formula C28H29N3O4S3 and a molecular weight of 567.76 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 23879097 |
| Molecular Formula | C28H29N3O4S3 |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)Nc3sc4c(c3-c3nc5ccccc5s3)CCCC4)cc2)CC(C)O1 |
| InChI | InChI=1S/C28H29N3O4S3/c1-17-15-31(16-18(2)35-17)38(33,34)20-13-11-19(12-14-20)26(32)30-28-25(21-7-3-5-9-23(21)36-28)27-29-22-8-4-6-10-24(22)37-27/h4,6,8,10-14,17-18H,3,5,7,9,15-16H2,1-2H3,(H,30,32) |
| InChIKey | KQZNLNRYDVWRRB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |