C27H28N2O2S2 — CID 4205184
N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-pentoxybenzamide (PubChem CID 4205184) has the molecular formula C27H28N2O2S2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-pentoxybenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 4205184 |
| Molecular Formula | C27H28N2O2S2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2sc3c(c2-c2nc4ccccc4s2)CCCC3)cc1 |
| InChI | InChI=1S/C27H28N2O2S2/c1-2-3-8-17-31-19-15-13-18(14-16-19)25(30)29-27-24(20-9-4-6-11-22(20)32-27)26-28-21-10-5-7-12-23(21)33-26/h5,7,10,12-16H,2-4,6,8-9,11,17H2,1H3,(H,29,30) |
| InChIKey | QFKZZOHMXYQDQX-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|