C17H16Cl3NO2 — CID 4936163
4-butoxy-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 4936163) has the molecular formula C17H16Cl3NO2 and a molecular weight of 372.68 g/mol. Its IUPAC name is 4-butoxy-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 4-butoxy-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 4936163 |
| Molecular Formula | C17H16Cl3NO2 |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 4-butoxy-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl3NO2/c1-2-3-8-23-12-6-4-11(5-7-12)17(22)21-16-10-14(19)13(18)9-15(16)20/h4-7,9-10H,2-3,8H2,1H3,(H,21,22) |
| InChIKey | JNPSJSKCQQZSRL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|