C21H25ClN2O3 — CID 55799104
N-[2-chloro-5-(propanoylamino)phenyl]-4-pentoxybenzamide (PubChem CID 55799104) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[2-chloro-5-(propanoylamino)phenyl]-4-pentoxybenzamide.
| Compound Name | N-[2-chloro-5-(propanoylamino)phenyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 55799104 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[2-chloro-5-(propanoylamino)phenyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2cc(NC(=O)CC)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O3/c1-3-5-6-13-27-17-10-7-15(8-11-17)21(26)24-19-14-16(9-12-18(19)22)23-20(25)4-2/h7-12,14H,3-6,13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | CDCDDUICJJEGKQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|