C23H17Cl2N3O3S2 — CID 17316107
N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]-3,4-dimethoxybenzamide (PubChem CID 17316107) has the molecular formula C23H17Cl2N3O3S2 and a molecular weight of 518.45 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17316107 |
| Molecular Formula | C23H17Cl2N3O3S2 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2c(Cl)cc(Cl)cc2-c2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C23H17Cl2N3O3S2/c1-30-17-8-7-12(9-18(17)31-2)21(29)28-23(32)27-20-14(10-13(24)11-15(20)25)22-26-16-5-3-4-6-19(16)33-22/h3-11H,1-2H3,(H2,27,28,29,32) |
| InChIKey | MCFPPNVKCAGJMG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|