C23H18BrN3O3S2 — CID 3298136
N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-3,4-dimethoxybenzamide (PubChem CID 3298136) has the molecular formula C23H18BrN3O3S2 and a molecular weight of 528.45 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3298136 |
| Molecular Formula | C23H18BrN3O3S2 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(Br)cc2-c2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C23H18BrN3O3S2/c1-29-18-10-7-13(11-19(18)30-2)21(28)27-23(31)26-16-9-8-14(24)12-15(16)22-25-17-5-3-4-6-20(17)32-22/h3-12H,1-2H3,(H2,26,27,28,31) |
| InChIKey | WPDFORKUWFQDSN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|