C23H17BrClN3O2S2 — CID 3290495
N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-3-chloro-4-ethoxybenzamide (PubChem CID 3290495) has the molecular formula C23H17BrClN3O2S2 and a molecular weight of 546.90 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-3-chloro-4-ethoxybenzamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-3-chloro-4-ethoxybenzamide |
|---|---|
| PubChem CID | 3290495 |
| Molecular Formula | C23H17BrClN3O2S2 |
| Molecular Weight | 546.90 g/mol |
| Exact Mass | 544.96 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)-4-bromophenyl]carbamothioyl]-3-chloro-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccc(Br)cc2-c2nc3ccccc3s2)cc1Cl |
| InChI | InChI=1S/C23H17BrClN3O2S2/c1-2-30-19-10-7-13(11-16(19)25)21(29)28-23(31)27-17-9-8-14(24)12-15(17)22-26-18-5-3-4-6-20(18)32-22/h3-12H,2H2,1H3,(H2,27,28,29,31) |
| InChIKey | OVGUVSJZALQRHO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.90 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|