C22H14Cl2N4O3S2 — CID 3598133
N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-4-methyl-3-nitrobenzamide (PubChem CID 3598133) has the molecular formula C22H14Cl2N4O3S2 and a molecular weight of 517.42 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 3598133 |
| Molecular Formula | C22H14Cl2N4O3S2 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2cc(-c3nc4ccccc4s3)c(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14Cl2N4O3S2/c1-11-6-7-12(8-18(11)28(30)31)20(29)27-22(32)26-17-9-13(14(23)10-15(17)24)21-25-16-4-2-3-5-19(16)33-21/h2-10H,1H3,(H2,26,27,29,32) |
| InChIKey | LHDSYBNHYIBHBF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|