C20H11ClIN3O3S — CID 3668346
N-[2-(1,3-benzothiazol-2-yl)-4-iodophenyl]-4-chloro-3-nitrobenzamide (PubChem CID 3668346) has the molecular formula C20H11ClIN3O3S and a molecular weight of 535.75 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)-4-iodophenyl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)-4-iodophenyl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 3668346 |
| Molecular Formula | C20H11ClIN3O3S |
| Molecular Weight | 535.75 g/mol |
| Exact Mass | 534.93 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)-4-iodophenyl]-4-chloro-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(I)cc1-c1nc2ccccc2s1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H11ClIN3O3S/c21-14-7-5-11(9-17(14)25(27)28)19(26)23-15-8-6-12(22)10-13(15)20-24-16-3-1-2-4-18(16)29-20/h1-10H,(H,23,26) |
| InChIKey | LHGNWOVVJCQRNU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.75 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|