C24H19IN4O4S — CID 3631036
N-[2-(1,3-benzothiazol-2-yl)-4-iodophenyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 3631036) has the molecular formula C24H19IN4O4S and a molecular weight of 586.41 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)-4-iodophenyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)-4-iodophenyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 3631036 |
| Molecular Formula | C24H19IN4O4S |
| Molecular Weight | 586.41 g/mol |
| Exact Mass | 586.02 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)-4-iodophenyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | O=C(Nc1ccc(I)cc1-c1nc2ccccc2s1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19IN4O4S/c25-16-6-7-18(17(14-16)24-27-19-3-1-2-4-22(19)34-24)26-23(30)15-5-8-20(21(13-15)29(31)32)28-9-11-33-12-10-28/h1-8,13-14H,9-12H2,(H,26,30) |
| InChIKey | IYNOAZNFAYKRKS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|