C25H22N4O5S — CID 17116585
N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 17116585) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 17116585 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-methoxyphenyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | COc1ccc(-c2nc3ccccc3s2)cc1NC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H22N4O5S/c1-33-22-9-7-17(25-27-18-4-2-3-5-23(18)35-25)14-19(22)26-24(30)16-6-8-20(21(15-16)29(31)32)28-10-12-34-13-11-28/h2-9,14-15H,10-13H2,1H3,(H,26,30) |
| InChIKey | IJHUKNHJGIHYQY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|