C25H19Br2N5O3S2 — CID 17316269
N-[[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 17316269) has the molecular formula C25H19Br2N5O3S2 and a molecular weight of 661.40 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17316269 |
| Molecular Formula | C25H19Br2N5O3S2 |
| Molecular Weight | 661.40 g/mol |
| Exact Mass | 658.93 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)Nc1c(Br)cc(Br)cc1-c1nc2ccccc2s1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H19Br2N5O3S2/c26-15-12-16(24-28-18-5-1-2-6-21(18)37-24)22(17(27)13-15)29-25(36)30-23(33)14-7-8-19(20(11-14)32(34)35)31-9-3-4-10-31/h1-2,5-8,11-13H,3-4,9-10H2,(H2,29,30,33,36) |
| InChIKey | UOPISBVVCLBPJS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.40 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|