C22H25N5O3S — CID 22781099
3-nitro-4-pyrrolidin-1-yl-N-[(4-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide (PubChem CID 22781099) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 3-nitro-4-pyrrolidin-1-yl-N-[(4-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide.
| Compound Name | 3-nitro-4-pyrrolidin-1-yl-N-[(4-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 22781099 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 3-nitro-4-pyrrolidin-1-yl-N-[(4-pyrrolidin-1-ylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCCC2)cc1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25N5O3S/c28-21(16-5-10-19(20(15-16)27(29)30)26-13-3-4-14-26)24-22(31)23-17-6-8-18(9-7-17)25-11-1-2-12-25/h5-10,15H,1-4,11-14H2,(H2,23,24,28,31) |
| InChIKey | GZBTYOSREDPBAK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|