C25H31N5O3S — CID 40862482
N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 40862482) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 40862482 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | C[C@H]1CCCCN1c1ccc(NC(=S)NC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H31N5O3S/c1-18-7-3-6-16-29(18)21-11-9-20(10-12-21)26-25(34)27-24(31)19-8-13-22(23(17-19)30(32)33)28-14-4-2-5-15-28/h8-13,17-18H,2-7,14-16H2,1H3,(H2,26,27,31,34)/t18-/m0/s1 |
| InChIKey | GLJHKYPMWNIGDM-SFHVURJKSA-N |
| XLogP | 5.09 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|