C28H36N6O4S — CID 43913908
4-(4-methylpiperidin-1-yl)-N-[[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-nitrobenzamide (PubChem CID 43913908) has the molecular formula C28H36N6O4S and a molecular weight of 552.70 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)-N-[[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | 4-(4-methylpiperidin-1-yl)-N-[[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 43913908 |
| Molecular Formula | C28H36N6O4S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)-N-[[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]carbamothioyl]-3-nitrobenzamide |
| SMILES | CC1CCN(c2ccc(C(=O)NC(=S)Nc3ccc(N4CCN(C(=O)C(C)C)CC4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C28H36N6O4S/c1-19(2)27(36)33-16-14-31(15-17-33)23-7-5-22(6-8-23)29-28(39)30-26(35)21-4-9-24(25(18-21)34(37)38)32-12-10-20(3)11-13-32/h4-9,18-20H,10-17H2,1-3H3,(H2,29,30,35,39) |
| InChIKey | DBBULDSAUKUDOR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|