C29H27F5N6O3S — CID 17318284
3-nitro-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-4-piperidin-1-ylbenzamide (PubChem CID 17318284) has the molecular formula C29H27F5N6O3S and a molecular weight of 634.63 g/mol. Its IUPAC name is 3-nitro-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-nitro-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17318284 |
| Molecular Formula | C29H27F5N6O3S |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | 3-nitro-N-[[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-4-piperidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)cc1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27F5N6O3S/c30-22-23(31)25(33)27(26(34)24(22)32)39-14-12-37(13-15-39)19-7-5-18(6-8-19)35-29(44)36-28(41)17-4-9-20(21(16-17)40(42)43)38-10-2-1-3-11-38/h4-9,16H,1-3,10-15H2,(H2,35,36,41,44) |
| InChIKey | JCMGOBKTARRPBC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|