C18H17N5O5S — CID 22776436
3-nitro-N-[(4-nitrophenyl)carbamothioyl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 22776436) has the molecular formula C18H17N5O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is 3-nitro-N-[(4-nitrophenyl)carbamothioyl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-nitro-N-[(4-nitrophenyl)carbamothioyl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 22776436 |
| Molecular Formula | C18H17N5O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 3-nitro-N-[(4-nitrophenyl)carbamothioyl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)Nc1ccc([N+](=O)[O-])cc1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17N5O5S/c24-17(20-18(29)19-13-4-6-14(7-5-13)22(25)26)12-3-8-15(16(11-12)23(27)28)21-9-1-2-10-21/h3-8,11H,1-2,9-10H2,(H2,19,20,24,29) |
| InChIKey | OTIDQTHBMHVBCG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|