C19H20N6O5S — CID 17104210
3-nitro-N-[(4-nitroanilino)carbamothioyl]-4-piperidin-1-ylbenzamide (PubChem CID 17104210) has the molecular formula C19H20N6O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is 3-nitro-N-[(4-nitroanilino)carbamothioyl]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-nitro-N-[(4-nitroanilino)carbamothioyl]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17104210 |
| Molecular Formula | C19H20N6O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 3-nitro-N-[(4-nitroanilino)carbamothioyl]-4-piperidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)NNc1ccc([N+](=O)[O-])cc1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N6O5S/c26-18(20-19(31)22-21-14-5-7-15(8-6-14)24(27)28)13-4-9-16(17(12-13)25(29)30)23-10-2-1-3-11-23/h4-9,12,21H,1-3,10-11H2,(H2,20,22,26,31) |
| InChIKey | KPQKRAUUGSWCAH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|