C18H15Cl3N4O3S — CID 17114122
3-nitro-4-pyrrolidin-1-yl-N-[(2,4,6-trichlorophenyl)carbamothioyl]benzamide (PubChem CID 17114122) has the molecular formula C18H15Cl3N4O3S and a molecular weight of 473.77 g/mol. Its IUPAC name is 3-nitro-4-pyrrolidin-1-yl-N-[(2,4,6-trichlorophenyl)carbamothioyl]benzamide.
| Compound Name | 3-nitro-4-pyrrolidin-1-yl-N-[(2,4,6-trichlorophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17114122 |
| Molecular Formula | C18H15Cl3N4O3S |
| Molecular Weight | 473.77 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 3-nitro-4-pyrrolidin-1-yl-N-[(2,4,6-trichlorophenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1c(Cl)cc(Cl)cc1Cl)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15Cl3N4O3S/c19-11-8-12(20)16(13(21)9-11)22-18(29)23-17(26)10-3-4-14(15(7-10)25(27)28)24-5-1-2-6-24/h3-4,7-9H,1-2,5-6H2,(H2,22,23,26,29) |
| InChIKey | SEOSZECWGVSEOF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|