C18H18ClN5O3S — CID 17018388
N-[(2-chloro-3-pyridinyl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 17018388) has the molecular formula C18H18ClN5O3S and a molecular weight of 419.89 g/mol. Its IUPAC name is N-[(2-chloro-3-pyridinyl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[(2-chloro-3-pyridinyl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17018388 |
| Molecular Formula | C18H18ClN5O3S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[(2-chloro-3-pyridinyl)carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | O=C(NC(=S)Nc1cccnc1Cl)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18ClN5O3S/c19-16-13(5-4-8-20-16)21-18(28)22-17(25)12-6-7-14(15(11-12)24(26)27)23-9-2-1-3-10-23/h4-8,11H,1-3,9-10H2,(H2,21,22,25,28) |
| InChIKey | ULXAEVJNJGAOMW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|