C22H24ClN5O4S — CID 17115682
N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 17115682) has the molecular formula C22H24ClN5O4S and a molecular weight of 489.99 g/mol. Its IUPAC name is N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17115682 |
| Molecular Formula | C22H24ClN5O4S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | CCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H24ClN5O4S/c1-2-20(29)24-15-7-8-16(23)17(13-15)25-22(33)26-21(30)14-6-9-18(19(12-14)28(31)32)27-10-4-3-5-11-27/h6-9,12-13H,2-5,10-11H2,1H3,(H,24,29)(H2,25,26,30,33) |
| InChIKey | OIROPZHAKPAKRA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|