C22H24ClN5O4S — CID 2972421
N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 2972421) has the molecular formula C22H24ClN5O4S and a molecular weight of 489.99 g/mol. Its IUPAC name is N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 2972421 |
| Molecular Formula | C22H24ClN5O4S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-[(3-chloro-2-pyrrolidin-1-ylphenyl)carbamothioyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1cccc(Cl)c1N1CCCC1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24ClN5O4S/c23-16-4-3-5-17(20(16)27-8-1-2-9-27)24-22(33)25-21(29)15-6-7-18(19(14-15)28(30)31)26-10-12-32-13-11-26/h3-7,14H,1-2,8-13H2,(H2,24,25,29,33) |
| InChIKey | HRKULTDXAUVEMS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|