C18H17ClN4O4S — CID 3506525
N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-3-nitrobenzamide (PubChem CID 3506525) has the molecular formula C18H17ClN4O4S and a molecular weight of 420.88 g/mol. Its IUPAC name is N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-3-nitrobenzamide.
| Compound Name | N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3506525 |
| Molecular Formula | C18H17ClN4O4S |
| Molecular Weight | 420.88 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-3-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1cccc(Cl)c1N1CCOCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17ClN4O4S/c19-14-5-2-6-15(16(14)22-7-9-27-10-8-22)20-18(28)21-17(24)12-3-1-4-13(11-12)23(25)26/h1-6,11H,7-10H2,(H2,20,21,24,28) |
| InChIKey | UFRSRQMZKGUAHZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|