C22H18Cl3N3O3S — CID 17114167
N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17114167) has the molecular formula C22H18Cl3N3O3S and a molecular weight of 510.83 g/mol. Its IUPAC name is N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17114167 |
| Molecular Formula | C22H18Cl3N3O3S |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(Cl)c1N1CCOCC1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C22H18Cl3N3O3S/c23-14-5-4-13(12-16(14)25)18-6-7-19(31-18)21(29)27-22(32)26-17-3-1-2-15(24)20(17)28-8-10-30-11-9-28/h1-7,12H,8-11H2,(H2,26,27,29,32) |
| InChIKey | BAIFZNYGSQHZHW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|