C15H14BrClN2O3 — CID 1017993
5-bromo-N-(3-chloro-2-morpholin-4-ylphenyl)furan-2-carboxamide (PubChem CID 1017993) has the molecular formula C15H14BrClN2O3 and a molecular weight of 385.65 g/mol. Its IUPAC name is 5-bromo-N-(3-chloro-2-morpholin-4-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(3-chloro-2-morpholin-4-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1017993 |
| Molecular Formula | C15H14BrClN2O3 |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 5-bromo-N-(3-chloro-2-morpholin-4-ylphenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1N1CCOCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H14BrClN2O3/c16-13-5-4-12(22-13)15(20)18-11-3-1-2-10(17)14(11)19-6-8-21-9-7-19/h1-5H,6-9H2,(H,18,20) |
| InChIKey | BWIZAYDZYSWFAD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |