C20H18BrClN2O3 — CID 118984847
6-bromo-N-(3-chloro-2-morpholin-4-ylphenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 118984847) has the molecular formula C20H18BrClN2O3 and a molecular weight of 449.73 g/mol. Its IUPAC name is 6-bromo-N-(3-chloro-2-morpholin-4-ylphenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 6-bromo-N-(3-chloro-2-morpholin-4-ylphenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 118984847 |
| Molecular Formula | C20H18BrClN2O3 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 6-bromo-N-(3-chloro-2-morpholin-4-ylphenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(Cl)c2N2CCOCC2)oc2cc(Br)ccc12 |
| InChI | InChI=1S/C20H18BrClN2O3/c1-12-14-6-5-13(21)11-17(14)27-19(12)20(25)23-16-4-2-3-15(22)18(16)24-7-9-26-10-8-24/h2-6,11H,7-10H2,1H3,(H,23,25) |
| InChIKey | USHVFIKHEUYAKS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |