C18H17Cl3N2O3 — CID 4029398
3,5-dichloro-N-(3-chloro-2-morpholin-4-ylphenyl)-4-methoxybenzamide (PubChem CID 4029398) has the molecular formula C18H17Cl3N2O3 and a molecular weight of 415.70 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-chloro-2-morpholin-4-ylphenyl)-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-(3-chloro-2-morpholin-4-ylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 4029398 |
| Molecular Formula | C18H17Cl3N2O3 |
| Molecular Weight | 415.70 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 3,5-dichloro-N-(3-chloro-2-morpholin-4-ylphenyl)-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2cccc(Cl)c2N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C18H17Cl3N2O3/c1-25-17-13(20)9-11(10-14(17)21)18(24)22-15-4-2-3-12(19)16(15)23-5-7-26-8-6-23/h2-4,9-10H,5-8H2,1H3,(H,22,24) |
| InChIKey | BKILNLIEZFVWSD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |