C18H11BrCl2N2O2S — CID 17103816
N-[(3-bromophenyl)carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17103816) has the molecular formula C18H11BrCl2N2O2S and a molecular weight of 470.18 g/mol. Its IUPAC name is N-[(3-bromophenyl)carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[(3-bromophenyl)carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17103816 |
| Molecular Formula | C18H11BrCl2N2O2S |
| Molecular Weight | 470.18 g/mol |
| Exact Mass | 467.91 |
| IUPAC Name | N-[(3-bromophenyl)carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(Br)c1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C18H11BrCl2N2O2S/c19-11-2-1-3-12(9-11)22-18(26)23-17(24)16-7-6-15(25-16)10-4-5-13(20)14(21)8-10/h1-9H,(H2,22,23,24,26) |
| InChIKey | QBKCFLYQUBONFD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.18 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|