C18H12N4O6S — CID 3567710
5-(4-nitrophenyl)-N-[(3-nitrophenyl)carbamothioyl]furan-2-carboxamide (PubChem CID 3567710) has the molecular formula C18H12N4O6S and a molecular weight of 412.38 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-N-[(3-nitrophenyl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-nitrophenyl)-N-[(3-nitrophenyl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3567710 |
| Molecular Formula | C18H12N4O6S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 5-(4-nitrophenyl)-N-[(3-nitrophenyl)carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc([N+](=O)[O-])c1)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C18H12N4O6S/c23-17(20-18(29)19-12-2-1-3-14(10-12)22(26)27)16-9-8-15(28-16)11-4-6-13(7-5-11)21(24)25/h1-10H,(H2,19,20,23,29) |
| InChIKey | UOHYFGPQMGNOFS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|