C25H16Cl2N4O5S — CID 3593536
N-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 3593536) has the molecular formula C25H16Cl2N4O5S and a molecular weight of 555.40 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3593536 |
| Molecular Formula | C25H16Cl2N4O5S |
| Molecular Weight | 555.40 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | N-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C25H16Cl2N4O5S/c26-15-4-9-19(20(27)13-15)23(32)28-16-5-7-17(8-6-16)29-25(37)30-24(33)22-11-10-21(36-22)14-2-1-3-18(12-14)31(34)35/h1-13H,(H,28,32)(H2,29,30,33,37) |
| InChIKey | ZQIIYFRVQYFGOG-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.40 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|