C22H17N3O8S — CID 3530867
dimethyl 5-[[5-(3-nitrophenyl)furan-2-carbonyl]carbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 3530867) has the molecular formula C22H17N3O8S and a molecular weight of 483.46 g/mol. Its IUPAC name is dimethyl 5-[[5-(3-nitrophenyl)furan-2-carbonyl]carbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[5-(3-nitrophenyl)furan-2-carbonyl]carbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3530867 |
| Molecular Formula | C22H17N3O8S |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | dimethyl 5-[[5-(3-nitrophenyl)furan-2-carbonyl]carbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)NC(=O)c2ccc(-c3cccc([N+](=O)[O-])c3)o2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H17N3O8S/c1-31-20(27)13-8-14(21(28)32-2)10-15(9-13)23-22(34)24-19(26)18-7-6-17(33-18)12-4-3-5-16(11-12)25(29)30/h3-11H,1-2H3,(H2,23,24,26,34) |
| InChIKey | KABGOURRVZECND-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 150.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|