C24H22N4O7S — CID 17336527
methyl 4-morpholin-4-yl-3-[[5-(3-nitrophenyl)furan-2-carbonyl]carbamothioylamino]benzoate (PubChem CID 17336527) has the molecular formula C24H22N4O7S and a molecular weight of 510.53 g/mol. Its IUPAC name is methyl 4-morpholin-4-yl-3-[[5-(3-nitrophenyl)furan-2-carbonyl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-morpholin-4-yl-3-[[5-(3-nitrophenyl)furan-2-carbonyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17336527 |
| Molecular Formula | C24H22N4O7S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | methyl 4-morpholin-4-yl-3-[[5-(3-nitrophenyl)furan-2-carbonyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCOCC2)c(NC(=S)NC(=O)c2ccc(-c3cccc([N+](=O)[O-])c3)o2)c1 |
| InChI | InChI=1S/C24H22N4O7S/c1-33-23(30)16-5-6-19(27-9-11-34-12-10-27)18(14-16)25-24(36)26-22(29)21-8-7-20(35-21)15-3-2-4-17(13-15)28(31)32/h2-8,13-14H,9-12H2,1H3,(H2,25,26,29,36) |
| InChIKey | LPGWWRPACBDYJD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|