C18H11FIN3O4S — CID 17115383
N-[(2-fluoro-4-iodophenyl)carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 17115383) has the molecular formula C18H11FIN3O4S and a molecular weight of 511.27 g/mol. Its IUPAC name is N-[(2-fluoro-4-iodophenyl)carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[(2-fluoro-4-iodophenyl)carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17115383 |
| Molecular Formula | C18H11FIN3O4S |
| Molecular Weight | 511.27 g/mol |
| Exact Mass | 510.95 |
| IUPAC Name | N-[(2-fluoro-4-iodophenyl)carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(I)cc1F)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C18H11FIN3O4S/c19-13-9-11(20)4-5-14(13)21-18(28)22-17(24)16-7-6-15(27-16)10-2-1-3-12(8-10)23(25)26/h1-9H,(H2,21,22,24,28) |
| InChIKey | CUXGUXQYTNNCCT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|